C19H19ClF3NO9 — CID 155182135
2-nitrooxyethoxycarbonyloxymethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155182135) has the molecular formula C19H19ClF3NO9 and a molecular weight of 497.81 g/mol. Its IUPAC name is 2-nitrooxyethoxycarbonyloxymethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 2-nitrooxyethoxycarbonyloxymethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155182135 |
| Molecular Formula | C19H19ClF3NO9 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 2-nitrooxyethoxycarbonyloxymethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(C)(C)c1cc2c(cc1Cl)C=C(C(=O)OCOC(=O)OCCO[N+](=O)[O-])C(C(F)(F)F)O2 |
| InChI | InChI=1S/C19H19ClF3NO9/c1-18(2,3)12-8-14-10(7-13(12)20)6-11(15(33-14)19(21,22)23)16(25)30-9-31-17(26)29-4-5-32-24(27)28/h6-8,15H,4-5,9H2,1-3H3 |
| InChIKey | RBNNFZFIEFCACI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|