C21H25ClF3NO8 — CID 144889593
3-(hydroxyamino)oxybutoxycarbonyloxymethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 144889593) has the molecular formula C21H25ClF3NO8 and a molecular weight of 511.88 g/mol. Its IUPAC name is 3-(hydroxyamino)oxybutoxycarbonyloxymethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 3-(hydroxyamino)oxybutoxycarbonyloxymethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 144889593 |
| Molecular Formula | C21H25ClF3NO8 |
| Molecular Weight | 511.88 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 3-(hydroxyamino)oxybutoxycarbonyloxymethyl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(CCOC(=O)OCOC(=O)C1=Cc2cc(Cl)c(C(C)(C)C)cc2OC1C(F)(F)F)ONO |
| InChI | InChI=1S/C21H25ClF3NO8/c1-11(34-26-29)5-6-30-19(28)32-10-31-18(27)13-7-12-8-15(22)14(20(2,3)4)9-16(12)33-17(13)21(23,24)25/h7-9,11,17,26,29H,5-6,10H2,1-4H3 |
| InChIKey | IHZTWOTWUSFJAO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.88 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|