C23H31ClF3N3O6 — CID 144889818
(Z)-[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino-[[(2S)-1-hydroxy-4-methylpentan-2-yl]-methylamino]-oxidoazanium (PubChem CID 144889818) has the molecular formula C23H31ClF3N3O6 and a molecular weight of 537.96 g/mol. Its IUPAC name is (Z)-[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino-[[(2S)-1-hydroxy-4-methylpentan-2-yl]-methylamino]-oxidoazanium.
| Compound Name | (Z)-[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino-[[(2S)-1-hydroxy-4-methylpentan-2-yl]-methylamino]-oxidoazanium |
|---|---|
| PubChem CID | 144889818 |
| Molecular Formula | C23H31ClF3N3O6 |
| Molecular Weight | 537.96 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | (Z)-[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino-[[(2S)-1-hydroxy-4-methylpentan-2-yl]-methylamino]-oxidoazanium |
| SMILES | CC(C)C[C@@H](CO)N(C)/[N+]([O-])=N/OCOC(=O)C1=Cc2cc(Cl)c(C(C)(C)C)cc2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C23H31ClF3N3O6/c1-13(2)7-15(11-31)29(6)30(33)28-35-12-34-21(32)16-8-14-9-18(24)17(22(3,4)5)10-19(14)36-20(16)23(25,26)27/h8-10,13,15,20,31H,7,11-12H2,1-6H3/b30-28-/t15-,20-/m0/s1 |
| InChIKey | ZODYQUHOJPZACE-BUSWCOOYSA-N |
| XLogP | 4.99 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.96 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|