C19H24ClF3NO6+ — CID 144889694
2-[2-[7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxyethoxy]ethoxy-hydroxyazanium (PubChem CID 144889694) has the molecular formula C19H24ClF3NO6+ and a molecular weight of 454.85 g/mol. Its IUPAC name is 2-[2-[7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxyethoxy]ethoxy-hydroxyazanium.
| Compound Name | 2-[2-[7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxyethoxy]ethoxy-hydroxyazanium |
|---|---|
| PubChem CID | 144889694 |
| Molecular Formula | C19H24ClF3NO6+ |
| Molecular Weight | 454.85 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-[2-[7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxyethoxy]ethoxy-hydroxyazanium |
| SMILES | CC(C)(C)c1cc2c(cc1Cl)C=C(C(=O)OCCOCCO[NH2+]O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C19H24ClF3NO6/c1-18(2,3)13-10-15-11(9-14(13)20)8-12(16(30-15)19(21,22)23)17(25)28-6-4-27-5-7-29-24-26/h8-10,16,26H,4-7,24H2,1-3H3/q+1 |
| InChIKey | GHEUWCAXXUTRLT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 90.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.85 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|