C21H22ClF3O6 — CID 118248661
[(3R,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 118248661) has the molecular formula C21H22ClF3O6 and a molecular weight of 462.85 g/mol. Its IUPAC name is [(3R,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | [(3R,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 118248661 |
| Molecular Formula | C21H22ClF3O6 |
| Molecular Weight | 462.85 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | [(3R,3aR,6S,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(C)(C)c1cc2c(cc1Cl)C=C(C(=O)O[C@H]1CO[C@H]3[C@@H]1OC[C@H]3O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C21H22ClF3O6/c1-20(2,3)11-6-14-9(5-12(11)22)4-10(18(30-14)21(23,24)25)19(27)31-15-8-29-16-13(26)7-28-17(15)16/h4-6,13,15-18,26H,7-8H2,1-3H3/t13-,15+,16-,17-,18?/m1/s1 |
| InChIKey | XCCOUYCGGXJYBE-GAMQSXCYSA-N |
| XLogP | 3.41 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.85 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |