C18H18ClF3N2O9 — CID 122699603
1,3-dinitrooxypropan-2-yl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 122699603) has the molecular formula C18H18ClF3N2O9 and a molecular weight of 498.79 g/mol. Its IUPAC name is 1,3-dinitrooxypropan-2-yl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 1,3-dinitrooxypropan-2-yl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 122699603 |
| Molecular Formula | C18H18ClF3N2O9 |
| Molecular Weight | 498.79 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | 1,3-dinitrooxypropan-2-yl 7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(C)(C)c1cc2c(cc1Cl)C=C(C(=O)OC(CO[N+](=O)[O-])CO[N+](=O)[O-])C(C(F)(F)F)O2 |
| InChI | InChI=1S/C18H18ClF3N2O9/c1-17(2,3)12-6-14-9(5-13(12)19)4-11(15(33-14)18(20,21)22)16(25)32-10(7-30-23(26)27)8-31-24(28)29/h4-6,10,15H,7-8H2,1-3H3 |
| InChIKey | PDDULXZSYYSRRQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 140.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.79 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|