C22H25ClF3N3O7 — CID 172959923
(Z)-[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino-(4-carboxypiperidin-1-yl)-oxidoazanium (PubChem CID 172959923) has the molecular formula C22H25ClF3N3O7 and a molecular weight of 535.90 g/mol. Its IUPAC name is (Z)-[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino-(4-carboxypiperidin-1-yl)-oxidoazanium.
| Compound Name | (Z)-[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino-(4-carboxypiperidin-1-yl)-oxidoazanium |
|---|---|
| PubChem CID | 172959923 |
| Molecular Formula | C22H25ClF3N3O7 |
| Molecular Weight | 535.90 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | (Z)-[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyimino-(4-carboxypiperidin-1-yl)-oxidoazanium |
| SMILES | CC(C)(C)c1cc2c(cc1Cl)C=C(C(=O)OCO/N=[N+](\[O-])N1CCC(C(=O)O)CC1)[C@@H](C(F)(F)F)O2 |
| InChI | InChI=1S/C22H25ClF3N3O7/c1-21(2,3)15-10-17-13(9-16(15)23)8-14(18(36-17)22(24,25)26)20(32)34-11-35-27-29(33)28-6-4-12(5-7-28)19(30)31/h8-10,12,18H,4-7,11H2,1-3H3,(H,30,31)/b29-27-/t18-/m0/s1 |
| InChIKey | AXELVPVTLJDHBK-OFGZUEHVSA-N |
| XLogP | 4.45 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.90 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|