C20H24ClF3N3O7+ — CID 144889848
[[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyamino]-[2-carboxyethyl(methyl)amino]-oxoazanium (PubChem CID 144889848) has the molecular formula C20H24ClF3N3O7+ and a molecular weight of 510.87 g/mol. Its IUPAC name is [[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyamino]-[2-carboxyethyl(methyl)amino]-oxoazanium.
| Compound Name | [[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyamino]-[2-carboxyethyl(methyl)amino]-oxoazanium |
|---|---|
| PubChem CID | 144889848 |
| Molecular Formula | C20H24ClF3N3O7+ |
| Molecular Weight | 510.87 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | [[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyamino]-[2-carboxyethyl(methyl)amino]-oxoazanium |
| SMILES | CN(CCC(=O)O)[N+](=O)NOCOC(=O)C1=Cc2cc(Cl)c(C(C)(C)C)cc2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C20H23ClF3N3O7/c1-19(2,3)13-9-15-11(8-14(13)21)7-12(17(34-15)20(22,23)24)18(30)32-10-33-25-27(31)26(4)6-5-16(28)29/h7-9,17H,5-6,10H2,1-4H3,(H-,25,28,29,31)/p+1/t17-/m0/s1 |
| InChIKey | BIDCORWPCCWDBP-KRWDZBQOSA-O |
| XLogP | 3.38 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.87 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|