C24H30ClF3N4O6 — CID 118222446
[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]oxymethyl (2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 118222446) has the molecular formula C24H30ClF3N4O6 and a molecular weight of 562.97 g/mol. Its IUPAC name is [(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]oxymethyl (2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | [(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]oxymethyl (2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 118222446 |
| Molecular Formula | C24H30ClF3N4O6 |
| Molecular Weight | 562.97 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | [(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]oxymethyl (2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CC(=O)N[C@@H](CCCN=C(N)N)C(=O)OCOC(=O)C1=Cc2cc(Cl)c(C(C)(C)C)cc2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C24H30ClF3N4O6/c1-12(33)32-17(6-5-7-31-22(29)30)21(35)37-11-36-20(34)14-8-13-9-16(25)15(23(2,3)4)10-18(13)38-19(14)24(26,27)28/h8-10,17,19H,5-7,11H2,1-4H3,(H,32,33)(H4,29,30,31)/t17-,19-/m0/s1 |
| InChIKey | AKZSEEVGWLKXFW-HKUYNNGSSA-N |
| XLogP | 2.95 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.97 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|