C21H26ClF3N4O4 — CID 118222374
(2S)-2-[[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 118222374) has the molecular formula C21H26ClF3N4O4 and a molecular weight of 490.91 g/mol. Its IUPAC name is (2S)-2-[[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 118222374 |
| Molecular Formula | C21H26ClF3N4O4 |
| Molecular Weight | 490.91 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (2S)-2-[[(2S)-7-tert-butyl-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)(C)c1cc2c(cc1Cl)C=C(C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)[C@@H](C(F)(F)F)O2 |
| InChI | InChI=1S/C21H26ClF3N4O4/c1-20(2,3)12-9-15-10(8-13(12)22)7-11(16(33-15)21(23,24)25)17(30)29-14(18(31)32)5-4-6-28-19(26)27/h7-9,14,16H,4-6H2,1-3H3,(H,29,30)(H,31,32)(H4,26,27,28)/t14-,16-/m0/s1 |
| InChIKey | KAODJTLBGUJWKM-HOCLYGCPSA-N |
| XLogP | 2.97 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.91 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|