C19H21Cl2F3N4O5 — CID 118222323
methyl 6-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoate (PubChem CID 118222323) has the molecular formula C19H21Cl2F3N4O5 and a molecular weight of 513.30 g/mol. Its IUPAC name is methyl 6-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoate.
| Compound Name | methyl 6-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 118222323 |
| Molecular Formula | C19H21Cl2F3N4O5 |
| Molecular Weight | 513.30 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | methyl 6-[[amino-(hydroxyamino)methylidene]amino]-2-[[(2S)-6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoate |
| SMILES | COC(=O)C(CCCC/N=C(\N)NO)NC(=O)C1=Cc2cc(Cl)cc(Cl)c2O[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C19H21Cl2F3N4O5/c1-32-17(30)13(4-2-3-5-26-18(25)28-31)27-16(29)11-7-9-6-10(20)8-12(21)14(9)33-15(11)19(22,23)24/h6-8,13,15,31H,2-5H2,1H3,(H,27,29)(H3,25,26,28)/t13?,15-/m0/s1 |
| InChIKey | ATGJDZRVVLIJCG-WUJWULDRSA-N |
| XLogP | 2.82 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|