C20H22F6N4O5 — CID 118222312
6-(diaminomethylideneamino)-2-[[(2S)-8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoic acid (PubChem CID 118222312) has the molecular formula C20H22F6N4O5 and a molecular weight of 512.41 g/mol. Its IUPAC name is 6-(diaminomethylideneamino)-2-[[(2S)-8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoic acid.
| Compound Name | 6-(diaminomethylideneamino)-2-[[(2S)-8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 118222312 |
| Molecular Formula | C20H22F6N4O5 |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 6-(diaminomethylideneamino)-2-[[(2S)-8-methyl-6-(trifluoromethoxy)-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]hexanoic acid |
| SMILES | Cc1cc(OC(F)(F)F)cc2c1O[C@H](C(F)(F)F)C(C(=O)NC(CCCCN=C(N)N)C(=O)O)=C2 |
| InChI | InChI=1S/C20H22F6N4O5/c1-9-6-11(35-20(24,25)26)7-10-8-12(15(19(21,22)23)34-14(9)10)16(31)30-13(17(32)33)4-2-3-5-29-18(27)28/h6-8,13,15H,2-5H2,1H3,(H,30,31)(H,32,33)(H4,27,28,29)/t13?,15-/m0/s1 |
| InChIKey | PHDSCXFGODIYBM-WUJWULDRSA-N |
| XLogP | 2.61 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|