C21H25BrF3N3O4 — CID 160813841
ethyl (2S)-7-amino-2-[[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]-7-iminoheptanoate (PubChem CID 160813841) has the molecular formula C21H25BrF3N3O4 and a molecular weight of 520.35 g/mol. Its IUPAC name is ethyl (2S)-7-amino-2-[[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]-7-iminoheptanoate.
| Compound Name | ethyl (2S)-7-amino-2-[[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]-7-iminoheptanoate |
|---|---|
| PubChem CID | 160813841 |
| Molecular Formula | C21H25BrF3N3O4 |
| Molecular Weight | 520.35 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | ethyl (2S)-7-amino-2-[[(2S)-6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]amino]-7-iminoheptanoate |
| SMILES | [H]/N=C(\N)CCCC[C@H](NC(=O)C1=Cc2cc(Br)cc(C)c2O[C@@H]1C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C21H25BrF3N3O4/c1-3-31-20(30)15(6-4-5-7-16(26)27)28-19(29)14-10-12-9-13(22)8-11(2)17(12)32-18(14)21(23,24)25/h8-10,15,18H,3-7H2,1-2H3,(H3,26,27)(H,28,29)/t15-,18-/m0/s1 |
| InChIKey | SEQLIJJEPCNXRK-YJBOKZPZSA-N |
| XLogP | 4.01 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|