C17H19BrF3N3O5 — CID 144889792
N-[[6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyamino]-N-methylazetidin-1-amine oxide (PubChem CID 144889792) has the molecular formula C17H19BrF3N3O5 and a molecular weight of 482.25 g/mol. Its IUPAC name is N-[[6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyamino]-N-methylazetidin-1-amine oxide.
| Compound Name | N-[[6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyamino]-N-methylazetidin-1-amine oxide |
|---|---|
| PubChem CID | 144889792 |
| Molecular Formula | C17H19BrF3N3O5 |
| Molecular Weight | 482.25 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | N-[[6-bromo-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carbonyl]oxymethoxyamino]-N-methylazetidin-1-amine oxide |
| SMILES | Cc1cc(Br)cc2c1OC(C(F)(F)F)C(C(=O)OCON[N+](C)([O-])N1CCC1)=C2 |
| InChI | InChI=1S/C17H19BrF3N3O5/c1-10-6-12(18)7-11-8-13(15(17(19,20)21)29-14(10)11)16(25)27-9-28-22-24(2,26)23-4-3-5-23/h6-8,15,22H,3-5,9H2,1-2H3 |
| InChIKey | JRPKHNQPRCBCCE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|