C16H22F8N3O5S+ — CID 144889751
aminooxymethyl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate;azetidine;hydroxyazanium (PubChem CID 144889751) has the molecular formula C16H22F8N3O5S+ and a molecular weight of 520.42 g/mol. Its IUPAC name is aminooxymethyl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate;azetidine;hydroxyazanium.
| Compound Name | aminooxymethyl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate;azetidine;hydroxyazanium |
|---|---|
| PubChem CID | 144889751 |
| Molecular Formula | C16H22F8N3O5S+ |
| Molecular Weight | 520.42 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | aminooxymethyl 8-methyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate;azetidine;hydroxyazanium |
| SMILES | C1CNC1.Cc1cc(S(F)(F)(F)(F)F)cc2c1OC(C(F)(F)F)C(C(=O)OCON)=C2.[NH3+]O |
| InChI | InChI=1S/C13H11F8NO4S.C3H7N.H4NO/c1-6-2-8(27(17,18,19,20)21)3-7-4-9(12(23)24-5-25-22)11(13(14,15)16)26-10(6)7;1-2-4-3-1;1-2/h2-4,11H,5,22H2,1H3;4H,1-3H2;2H,1H3/q;;+1 |
| InChIKey | WPRWWXRUEFLCKQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 130.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|