C18H19ClF3N3O5 — CID 154373500
[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]diazenyl]oxymethyl (2S)-6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 154373500) has the molecular formula C18H19ClF3N3O5 and a molecular weight of 449.81 g/mol. Its IUPAC name is [[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]diazenyl]oxymethyl (2S)-6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | [[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]diazenyl]oxymethyl (2S)-6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 154373500 |
| Molecular Formula | C18H19ClF3N3O5 |
| Molecular Weight | 449.81 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]diazenyl]oxymethyl (2S)-6-chloro-8-methyl-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | Cc1cc(Cl)cc2c1O[C@H](C(F)(F)F)C(C(=O)OCON=NN1CCC[C@H]1CO)=C2 |
| InChI | InChI=1S/C18H19ClF3N3O5/c1-10-5-12(19)6-11-7-14(16(18(20,21)22)30-15(10)11)17(27)28-9-29-24-23-25-4-2-3-13(25)8-26/h5-7,13,16,26H,2-4,8-9H2,1H3/t13-,16-/m0/s1 |
| InChIKey | RKIKMQIMXHTVJK-BBRMVZONSA-N |
| XLogP | 3.61 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.81 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|