C12H8Cl2F3NO4 — CID 144889799
aminooxymethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 144889799) has the molecular formula C12H8Cl2F3NO4 and a molecular weight of 358.10 g/mol. Its IUPAC name is aminooxymethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | aminooxymethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 144889799 |
| Molecular Formula | C12H8Cl2F3NO4 |
| Molecular Weight | 358.10 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | aminooxymethyl 6,8-dichloro-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | NOCOC(=O)C1=Cc2cc(Cl)cc(Cl)c2OC1C(F)(F)F |
| InChI | InChI=1S/C12H8Cl2F3NO4/c13-6-1-5-2-7(11(19)20-4-21-18)10(12(15,16)17)22-9(5)8(14)3-6/h1-3,10H,4,18H2 |
| InChIKey | BRRMZENQBVSNFO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.10 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|