C22H16ClF3O3 — CID 58934696
ethyl 6-chloro-8-[2-(4-methylphenyl)ethynyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 58934696) has the molecular formula C22H16ClF3O3 and a molecular weight of 420.81 g/mol. Its IUPAC name is ethyl 6-chloro-8-[2-(4-methylphenyl)ethynyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | ethyl 6-chloro-8-[2-(4-methylphenyl)ethynyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 58934696 |
| Molecular Formula | C22H16ClF3O3 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | ethyl 6-chloro-8-[2-(4-methylphenyl)ethynyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1=Cc2cc(Cl)cc(C#Cc3ccc(C)cc3)c2OC1C(F)(F)F |
| InChI | InChI=1S/C22H16ClF3O3/c1-3-28-21(27)18-12-16-11-17(23)10-15(19(16)29-20(18)22(24,25)26)9-8-14-6-4-13(2)5-7-14/h4-7,10-12,20H,3H2,1-2H3 |
| InChIKey | NVCHARHNAMZWSA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|