C19H9ClF4O3 — CID 11257991
6-chloro-8-[2-(2-fluorophenyl)ethynyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 11257991) has the molecular formula C19H9ClF4O3 and a molecular weight of 396.72 g/mol. Its IUPAC name is 6-chloro-8-[2-(2-fluorophenyl)ethynyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-8-[2-(2-fluorophenyl)ethynyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 11257991 |
| Molecular Formula | C19H9ClF4O3 |
| Molecular Weight | 396.72 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 6-chloro-8-[2-(2-fluorophenyl)ethynyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(Cl)cc(C#Cc3ccccc3F)c2OC1C(F)(F)F |
| InChI | InChI=1S/C19H9ClF4O3/c20-13-7-11(6-5-10-3-1-2-4-15(10)21)16-12(8-13)9-14(18(25)26)17(27-16)19(22,23)24/h1-4,7-9,17H,(H,25,26) |
| InChIKey | VHJHZIYKHWTQBW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.72 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|