C38H18Cl2F8O6 — CID 161345835
6-chloro-8-[2-(2-fluorophenyl)ethynyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 161345835) has the molecular formula C38H18Cl2F8O6 and a molecular weight of 793.45 g/mol. Its IUPAC name is 6-chloro-8-[2-(2-fluorophenyl)ethynyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-8-[2-(2-fluorophenyl)ethynyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 161345835 |
| Molecular Formula | C38H18Cl2F8O6 |
| Molecular Weight | 793.45 g/mol |
| Exact Mass | 792.04 |
| IUPAC Name | 6-chloro-8-[2-(2-fluorophenyl)ethynyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(Cl)cc(C#Cc3ccccc3F)c2OC1C(F)(F)F.O=C(O)C1=Cc2cc(Cl)cc(C#Cc3ccccc3F)c2OC1C(F)(F)F |
| InChI | InChI=1S/2C19H9ClF4O3/c2*20-13-7-11(6-5-10-3-1-2-4-15(10)21)16-12(8-13)9-14(18(25)26)17(27-16)19(22,23)24/h2*1-4,7-9,17H,(H,25,26) |
| InChIKey | VNGVEHSGELXIIP-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.45 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|