C18H9ClF6O4 — CID 11189854
6-chloro-8-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 11189854) has the molecular formula C18H9ClF6O4 and a molecular weight of 438.71 g/mol. Its IUPAC name is 6-chloro-8-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-8-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 11189854 |
| Molecular Formula | C18H9ClF6O4 |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 6-chloro-8-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(Cl)cc(-c3ccc(OC(F)(F)F)cc3)c2OC1C(F)(F)F |
| InChI | InChI=1S/C18H9ClF6O4/c19-10-5-9-6-13(16(26)27)15(17(20,21)22)28-14(9)12(7-10)8-1-3-11(4-2-8)29-18(23,24)25/h1-7,15H,(H,26,27) |
| InChIKey | JVZRUWFRZWPQTA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |