C19H13ClF3NO5 — CID 87889525
8-(3-amino-5-methoxycarbonylphenyl)-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 87889525) has the molecular formula C19H13ClF3NO5 and a molecular weight of 427.76 g/mol. Its IUPAC name is 8-(3-amino-5-methoxycarbonylphenyl)-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 8-(3-amino-5-methoxycarbonylphenyl)-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 87889525 |
| Molecular Formula | C19H13ClF3NO5 |
| Molecular Weight | 427.76 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 8-(3-amino-5-methoxycarbonylphenyl)-6-chloro-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | COC(=O)c1cc(N)cc(-c2cc(Cl)cc3c2OC(C(F)(F)F)C(C(=O)O)=C3)c1 |
| InChI | InChI=1S/C19H13ClF3NO5/c1-28-18(27)10-2-8(4-12(24)5-10)13-7-11(20)3-9-6-14(17(25)26)16(19(21,22)23)29-15(9)13/h2-7,16H,24H2,1H3,(H,25,26) |
| InChIKey | HJQRUHVHYJCORH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|