C18H12ClF3O4 — CID 174366672
6-chloro-8-(2-methoxyphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 174366672) has the molecular formula C18H12ClF3O4 and a molecular weight of 384.74 g/mol. Its IUPAC name is 6-chloro-8-(2-methoxyphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
| Compound Name | 6-chloro-8-(2-methoxyphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 174366672 |
| Molecular Formula | C18H12ClF3O4 |
| Molecular Weight | 384.74 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 6-chloro-8-(2-methoxyphenyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | COc1ccccc1-c1cc(Cl)cc2c1OC(C(F)(F)F)C(C(=O)O)=C2 |
| InChI | InChI=1S/C18H12ClF3O4/c1-25-14-5-3-2-4-11(14)12-8-10(19)6-9-7-13(17(23)24)16(18(20,21)22)26-15(9)12/h2-8,16H,1H3,(H,23,24) |
| InChIKey | HKOQHNOKGLHENL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.74 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |