C24H17ClO5 — CID 11154379
3-[3-(5-chloro-2-phenylmethoxyphenyl)-5-oxo-2H-furan-4-yl]benzoic acid (PubChem CID 11154379) has the molecular formula C24H17ClO5 and a molecular weight of 420.85 g/mol. Its IUPAC name is 3-[3-(5-chloro-2-phenylmethoxyphenyl)-5-oxo-2H-furan-4-yl]benzoic acid.
| Compound Name | 3-[3-(5-chloro-2-phenylmethoxyphenyl)-5-oxo-2H-furan-4-yl]benzoic acid |
|---|---|
| PubChem CID | 11154379 |
| Molecular Formula | C24H17ClO5 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 3-[3-(5-chloro-2-phenylmethoxyphenyl)-5-oxo-2H-furan-4-yl]benzoic acid |
| SMILES | O=C1OCC(c2cc(Cl)ccc2OCc2ccccc2)=C1c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C24H17ClO5/c25-18-9-10-21(29-13-15-5-2-1-3-6-15)19(12-18)20-14-30-24(28)22(20)16-7-4-8-17(11-16)23(26)27/h1-12H,13-14H2,(H,26,27) |
| InChIKey | PDNMYVBWSATOME-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|