C27H20ClNaO3 — CID 23677039
sodium 3-[2-(5-chloro-2-phenylmethoxyphenyl)-6-methylphenyl]benzoate (PubChem CID 23677039) has the molecular formula C27H20ClNaO3 and a molecular weight of 450.90 g/mol. Its IUPAC name is sodium 3-[2-(5-chloro-2-phenylmethoxyphenyl)-6-methylphenyl]benzoate.
| Compound Name | sodium 3-[2-(5-chloro-2-phenylmethoxyphenyl)-6-methylphenyl]benzoate |
|---|---|
| PubChem CID | 23677039 |
| Molecular Formula | C27H20ClNaO3 |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | sodium 3-[2-(5-chloro-2-phenylmethoxyphenyl)-6-methylphenyl]benzoate |
| SMILES | Cc1cccc(-c2cc(Cl)ccc2OCc2ccccc2)c1-c1cccc(C(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C27H21ClO3.Na/c1-18-7-5-12-23(26(18)20-10-6-11-21(15-20)27(29)30)24-16-22(28)13-14-25(24)31-17-19-8-3-2-4-9-19;/h2-16H,17H2,1H3,(H,29,30);/q;+1/p-1 |
| InChIKey | DODUUXHBBQECEY-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |