About ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate
ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate (PubChem CID 142890256) has the molecular formula C32H35ClO2
and a molecular weight of 487.08 g/mol. Its IUPAC name is ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate.
Molecular Properties
| Compound Name | ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate |
| PubChem CID | 142890256 |
| Molecular Formula | C32H35ClO2 |
| Molecular Weight | 487.08 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate |
| SMILES | CC.CCOC(=O)c1cccc(-c2ccccc2-c2cc(Cl)ccc2C)c1.CCc1ccccc1 |
| InChI | InChI=1S/C22H19ClO2.C8H10.C2H6/c1-3-25-22(24)17-8-6-7-16(13-17)19-9-4-5-10-20(19)21-14-18(23)12-11-15(21)2;1-2-8-6-4-3-5-7-8;1-2/h4-14H,3H2,1-2H3;3-7H,2H2,1H3;1-2H3 |
| InChIKey | JPGRHAZRFQWZCZ-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.08 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate?
The IUPAC name of ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate (CID 142890256) is ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate.
What is the SMILES notation for ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate?
The canonical SMILES for ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate is CC.CCOC(=O)c1cccc(-c2ccccc2-c2cc(Cl)ccc2C)c1.CCc1ccccc1.
What is the InChIKey of ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate?
The InChIKey is JPGRHAZRFQWZCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19ClO2.C8H10.C2H6/c1-3-25-22(24)17-8-6-7-16(13-17)19-9-4-5-10-20(19)21-14-18(23)12-11-15(21)2;1-2-8-6-4-3-5-7-8;1-2/h4-14H,3H2,1-2H3;3-7H,2H2,1H3;1-2H3.
What are the key properties of ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate?
ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate has a molecular weight of 487.08 g/mol, XLogP of 9.43, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethylbenzene;ethyl 3-[2-(5-chloro-2-methylphenyl)phenyl]benzoate is sourced from PubChem (CID 142890256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).