C24H18ClNO3 — CID 59654994
ethyl 3-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)benzoate (PubChem CID 59654994) has the molecular formula C24H18ClNO3 and a molecular weight of 403.87 g/mol. Its IUPAC name is ethyl 3-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)benzoate.
| Compound Name | ethyl 3-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)benzoate |
|---|---|
| PubChem CID | 59654994 |
| Molecular Formula | C24H18ClNO3 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | ethyl 3-(6-chloro-2-oxo-4-phenyl-1H-quinolin-3-yl)benzoate |
| SMILES | CCOC(=O)c1cccc(-c2c(-c3ccccc3)c3cc(Cl)ccc3[nH]c2=O)c1 |
| InChI | InChI=1S/C24H18ClNO3/c1-2-29-24(28)17-10-6-9-16(13-17)22-21(15-7-4-3-5-8-15)19-14-18(25)11-12-20(19)26-23(22)27/h3-14H,2H2,1H3,(H,26,27) |
| InChIKey | PMAWCMKJFLZXNF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |