C20H17ClN2O4 — CID 10500272
ethyl 3-[(7-chloro-2-oxo-3-phenyl-1H-quinolin-4-yl)amino]-3-oxopropanoate (PubChem CID 10500272) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is ethyl 3-[(7-chloro-2-oxo-3-phenyl-1H-quinolin-4-yl)amino]-3-oxopropanoate.
| Compound Name | ethyl 3-[(7-chloro-2-oxo-3-phenyl-1H-quinolin-4-yl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 10500272 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | ethyl 3-[(7-chloro-2-oxo-3-phenyl-1H-quinolin-4-yl)amino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1c(-c2ccccc2)c(=O)[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C20H17ClN2O4/c1-2-27-17(25)11-16(24)23-19-14-9-8-13(21)10-15(14)22-20(26)18(19)12-6-4-3-5-7-12/h3-10H,2,11H2,1H3,(H2,22,23,24,26) |
| InChIKey | QLIVXXJOASVTNK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|