C14H14ClN3O5 — CID 10088592
ethyl 3-[(7-chloro-3-nitro-2-oxo-1H-quinolin-4-yl)amino]propanoate (PubChem CID 10088592) has the molecular formula C14H14ClN3O5 and a molecular weight of 339.74 g/mol. Its IUPAC name is ethyl 3-[(7-chloro-3-nitro-2-oxo-1H-quinolin-4-yl)amino]propanoate.
| Compound Name | ethyl 3-[(7-chloro-3-nitro-2-oxo-1H-quinolin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 10088592 |
| Molecular Formula | C14H14ClN3O5 |
| Molecular Weight | 339.74 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | ethyl 3-[(7-chloro-3-nitro-2-oxo-1H-quinolin-4-yl)amino]propanoate |
| SMILES | CCOC(=O)CCNc1c([N+](=O)[O-])c(=O)[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C14H14ClN3O5/c1-2-23-11(19)5-6-16-12-9-4-3-8(15)7-10(9)17-14(20)13(12)18(21)22/h3-4,7H,2,5-6H2,1H3,(H2,16,17,20) |
| InChIKey | WQNJORXNOGNWJX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.74 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|