C16H15ClN4O4 — CID 18929941
ethyl 3-[(7-chloro-1,4-dioxo-2,3-dihydropyridazino[4,5-b]quinolin-10-yl)amino]propanoate (PubChem CID 18929941) has the molecular formula C16H15ClN4O4 and a molecular weight of 362.77 g/mol. Its IUPAC name is ethyl 3-[(7-chloro-1,4-dioxo-2,3-dihydropyridazino[4,5-b]quinolin-10-yl)amino]propanoate.
| Compound Name | ethyl 3-[(7-chloro-1,4-dioxo-2,3-dihydropyridazino[4,5-b]quinolin-10-yl)amino]propanoate |
|---|---|
| PubChem CID | 18929941 |
| Molecular Formula | C16H15ClN4O4 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | ethyl 3-[(7-chloro-1,4-dioxo-2,3-dihydropyridazino[4,5-b]quinolin-10-yl)amino]propanoate |
| SMILES | CCOC(=O)CCNc1c2ccc(Cl)cc2nc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C16H15ClN4O4/c1-2-25-11(22)5-6-18-13-9-4-3-8(17)7-10(9)19-14-12(13)15(23)20-21-16(14)24/h3-4,7H,2,5-6H2,1H3,(H,18,19)(H,20,23)(H,21,24) |
| InChIKey | PKYZOWAODWDGHB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|