C14H16FN3O2 — CID 83164635
ethyl 3-[(5-amino-7-fluoroquinolin-8-yl)amino]propanoate (PubChem CID 83164635) has the molecular formula C14H16FN3O2 and a molecular weight of 277.30 g/mol. Its IUPAC name is ethyl 3-[(5-amino-7-fluoroquinolin-8-yl)amino]propanoate.
| Compound Name | ethyl 3-[(5-amino-7-fluoroquinolin-8-yl)amino]propanoate |
|---|---|
| PubChem CID | 83164635 |
| Molecular Formula | C14H16FN3O2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | ethyl 3-[(5-amino-7-fluoroquinolin-8-yl)amino]propanoate |
| SMILES | CCOC(=O)CCNc1c(F)cc(N)c2cccnc12 |
| InChI | InChI=1S/C14H16FN3O2/c1-2-20-12(19)5-7-18-14-10(15)8-11(16)9-4-3-6-17-13(9)14/h3-4,6,8,18H,2,5,7,16H2,1H3 |
| InChIKey | WQTCFVNOSKORPZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|