C16H23FN4 — CID 83163867
8-N-[3-(diethylamino)propyl]-7-fluoroquinoline-5,8-diamine (PubChem CID 83163867) has the molecular formula C16H23FN4 and a molecular weight of 290.39 g/mol. Its IUPAC name is 8-N-[3-(diethylamino)propyl]-7-fluoroquinoline-5,8-diamine.
| Compound Name | 8-N-[3-(diethylamino)propyl]-7-fluoroquinoline-5,8-diamine |
|---|---|
| PubChem CID | 83163867 |
| Molecular Formula | C16H23FN4 |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 8-N-[3-(diethylamino)propyl]-7-fluoroquinoline-5,8-diamine |
| SMILES | CCN(CC)CCCNc1c(F)cc(N)c2cccnc12 |
| InChI | InChI=1S/C16H23FN4/c1-3-21(4-2)10-6-9-20-16-13(17)11-14(18)12-7-5-8-19-15(12)16/h5,7-8,11,20H,3-4,6,9-10,18H2,1-2H3 |
| InChIKey | RWPUGZHOQIGJRS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|