C13H13F4N3 — CID 83166181
7-fluoro-8-N-(4,4,4-trifluorobutyl)quinoline-5,8-diamine (PubChem CID 83166181) has the molecular formula C13H13F4N3 and a molecular weight of 287.26 g/mol. Its IUPAC name is 7-fluoro-8-N-(4,4,4-trifluorobutyl)quinoline-5,8-diamine.
| Compound Name | 7-fluoro-8-N-(4,4,4-trifluorobutyl)quinoline-5,8-diamine |
|---|---|
| PubChem CID | 83166181 |
| Molecular Formula | C13H13F4N3 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 7-fluoro-8-N-(4,4,4-trifluorobutyl)quinoline-5,8-diamine |
| SMILES | Nc1cc(F)c(NCCCC(F)(F)F)c2ncccc12 |
| InChI | InChI=1S/C13H13F4N3/c14-9-7-10(18)8-3-1-5-19-11(8)12(9)20-6-2-4-13(15,16)17/h1,3,5,7,20H,2,4,6,18H2 |
| InChIKey | WSYMMCYTMRJJOF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|