C15H20FN3O — CID 106183325
3-[(5-amino-7-fluoroquinolin-8-yl)amino]-2,3-dimethylbutan-2-ol (PubChem CID 106183325) has the molecular formula C15H20FN3O and a molecular weight of 277.34 g/mol. Its IUPAC name is 3-[(5-amino-7-fluoroquinolin-8-yl)amino]-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[(5-amino-7-fluoroquinolin-8-yl)amino]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 106183325 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 3-[(5-amino-7-fluoroquinolin-8-yl)amino]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)Nc1c(F)cc(N)c2cccnc12 |
| InChI | InChI=1S/C15H20FN3O/c1-14(2,15(3,4)20)19-13-10(16)8-11(17)9-6-5-7-18-12(9)13/h5-8,19-20H,17H2,1-4H3 |
| InChIKey | KWDPBNGHNWBGJH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|