C16H13ClFN3 — CID 83163913
8-N-(5-chloro-2-methylphenyl)-7-fluoroquinoline-5,8-diamine (PubChem CID 83163913) has the molecular formula C16H13ClFN3 and a molecular weight of 301.75 g/mol. Its IUPAC name is 8-N-(5-chloro-2-methylphenyl)-7-fluoroquinoline-5,8-diamine.
| Compound Name | 8-N-(5-chloro-2-methylphenyl)-7-fluoroquinoline-5,8-diamine |
|---|---|
| PubChem CID | 83163913 |
| Molecular Formula | C16H13ClFN3 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 8-N-(5-chloro-2-methylphenyl)-7-fluoroquinoline-5,8-diamine |
| SMILES | Cc1ccc(Cl)cc1Nc1c(F)cc(N)c2cccnc12 |
| InChI | InChI=1S/C16H13ClFN3/c1-9-4-5-10(17)7-14(9)21-16-12(18)8-13(19)11-3-2-6-20-15(11)16/h2-8,21H,19H2,1H3 |
| InChIKey | PLADPIVOLVFUMP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|