C15H10ClF2N3 — CID 83074548
8-N-(2-chloro-4,6-difluorophenyl)quinoline-5,8-diamine (PubChem CID 83074548) has the molecular formula C15H10ClF2N3 and a molecular weight of 305.72 g/mol. Its IUPAC name is 8-N-(2-chloro-4,6-difluorophenyl)quinoline-5,8-diamine.
| Compound Name | 8-N-(2-chloro-4,6-difluorophenyl)quinoline-5,8-diamine |
|---|---|
| PubChem CID | 83074548 |
| Molecular Formula | C15H10ClF2N3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 8-N-(2-chloro-4,6-difluorophenyl)quinoline-5,8-diamine |
| SMILES | Nc1ccc(Nc2c(F)cc(F)cc2Cl)c2ncccc12 |
| InChI | InChI=1S/C15H10ClF2N3/c16-10-6-8(17)7-11(18)15(10)21-13-4-3-12(19)9-2-1-5-20-14(9)13/h1-7,21H,19H2 |
| InChIKey | FLTQMVWXOBISGX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|