C12H7Cl3F2N2 — CID 83081059
4,5-dichloro-2-N-(2-chloro-4,6-difluorophenyl)benzene-1,2-diamine (PubChem CID 83081059) has the molecular formula C12H7Cl3F2N2 and a molecular weight of 323.56 g/mol. Its IUPAC name is 4,5-dichloro-2-N-(2-chloro-4,6-difluorophenyl)benzene-1,2-diamine.
| Compound Name | 4,5-dichloro-2-N-(2-chloro-4,6-difluorophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 83081059 |
| Molecular Formula | C12H7Cl3F2N2 |
| Molecular Weight | 323.56 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 4,5-dichloro-2-N-(2-chloro-4,6-difluorophenyl)benzene-1,2-diamine |
| SMILES | Nc1cc(Cl)c(Cl)cc1Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C12H7Cl3F2N2/c13-6-3-10(18)11(4-7(6)14)19-12-8(15)1-5(16)2-9(12)17/h1-4,19H,18H2 |
| InChIKey | RIBIPFSFMXMWEK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|