C11H7Cl2F2N3 — CID 114046291
3-chloro-2-N-(2-chloro-4,6-difluorophenyl)pyridine-2,5-diamine (PubChem CID 114046291) has the molecular formula C11H7Cl2F2N3 and a molecular weight of 290.10 g/mol. Its IUPAC name is 3-chloro-2-N-(2-chloro-4,6-difluorophenyl)pyridine-2,5-diamine.
| Compound Name | 3-chloro-2-N-(2-chloro-4,6-difluorophenyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 114046291 |
| Molecular Formula | C11H7Cl2F2N3 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 3-chloro-2-N-(2-chloro-4,6-difluorophenyl)pyridine-2,5-diamine |
| SMILES | Nc1cnc(Nc2c(F)cc(F)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H7Cl2F2N3/c12-7-1-5(14)2-9(15)10(7)18-11-8(13)3-6(16)4-17-11/h1-4H,16H2,(H,17,18) |
| InChIKey | LFSJYOYQEUXTQA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |