C11H6Cl2F2N2 — CID 83088172
5-chloro-N-(2-chloro-4,6-difluorophenyl)pyridin-2-amine (PubChem CID 83088172) has the molecular formula C11H6Cl2F2N2 and a molecular weight of 275.09 g/mol. Its IUPAC name is 5-chloro-N-(2-chloro-4,6-difluorophenyl)pyridin-2-amine.
| Compound Name | 5-chloro-N-(2-chloro-4,6-difluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 83088172 |
| Molecular Formula | C11H6Cl2F2N2 |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 5-chloro-N-(2-chloro-4,6-difluorophenyl)pyridin-2-amine |
| SMILES | Fc1cc(F)c(Nc2ccc(Cl)cn2)c(Cl)c1 |
| InChI | InChI=1S/C11H6Cl2F2N2/c12-6-1-2-10(16-5-6)17-11-8(13)3-7(14)4-9(11)15/h1-5H,(H,16,17) |
| InChIKey | LMCZUEWZDXBRBE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |