C11H7ClF2N4O2 — CID 83083529
6-N-(2-chloro-4,6-difluorophenyl)-3-nitropyridine-2,6-diamine (PubChem CID 83083529) has the molecular formula C11H7ClF2N4O2 and a molecular weight of 300.65 g/mol. Its IUPAC name is 6-N-(2-chloro-4,6-difluorophenyl)-3-nitropyridine-2,6-diamine.
| Compound Name | 6-N-(2-chloro-4,6-difluorophenyl)-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 83083529 |
| Molecular Formula | C11H7ClF2N4O2 |
| Molecular Weight | 300.65 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 6-N-(2-chloro-4,6-difluorophenyl)-3-nitropyridine-2,6-diamine |
| SMILES | Nc1nc(Nc2c(F)cc(F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H7ClF2N4O2/c12-6-3-5(13)4-7(14)10(6)16-9-2-1-8(18(19)20)11(15)17-9/h1-4H,(H3,15,16,17) |
| InChIKey | YUBHRCOKMCVGTI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.65 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|