C12H9ClF2N4O2 — CID 83075238
2-chloro-4,6-difluoro-N-(3-hydrazinyl-5-nitrophenyl)aniline (PubChem CID 83075238) has the molecular formula C12H9ClF2N4O2 and a molecular weight of 314.68 g/mol. Its IUPAC name is 2-chloro-4,6-difluoro-N-(3-hydrazinyl-5-nitrophenyl)aniline.
| Compound Name | 2-chloro-4,6-difluoro-N-(3-hydrazinyl-5-nitrophenyl)aniline |
|---|---|
| PubChem CID | 83075238 |
| Molecular Formula | C12H9ClF2N4O2 |
| Molecular Weight | 314.68 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2-chloro-4,6-difluoro-N-(3-hydrazinyl-5-nitrophenyl)aniline |
| SMILES | NNc1cc(Nc2c(F)cc(F)cc2Cl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H9ClF2N4O2/c13-10-1-6(14)2-11(15)12(10)17-7-3-8(18-16)5-9(4-7)19(20)21/h1-5,17-18H,16H2 |
| InChIKey | FCXWBCNOXQKXPX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.68 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|