C12H10F2N4O2 — CID 80928323
3,4-difluoro-N-(3-hydrazinyl-5-nitrophenyl)aniline (PubChem CID 80928323) has the molecular formula C12H10F2N4O2 and a molecular weight of 280.23 g/mol. Its IUPAC name is 3,4-difluoro-N-(3-hydrazinyl-5-nitrophenyl)aniline.
| Compound Name | 3,4-difluoro-N-(3-hydrazinyl-5-nitrophenyl)aniline |
|---|---|
| PubChem CID | 80928323 |
| Molecular Formula | C12H10F2N4O2 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 3,4-difluoro-N-(3-hydrazinyl-5-nitrophenyl)aniline |
| SMILES | NNc1cc(Nc2ccc(F)c(F)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10F2N4O2/c13-11-2-1-7(6-12(11)14)16-8-3-9(17-15)5-10(4-8)18(19)20/h1-6,16-17H,15H2 |
| InChIKey | ZQALUQJWIIDMRN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|