C12H8F3N3O2 — CID 80824941
5-nitro-3-N-(3,4,5-trifluorophenyl)benzene-1,3-diamine (PubChem CID 80824941) has the molecular formula C12H8F3N3O2 and a molecular weight of 283.21 g/mol. Its IUPAC name is 5-nitro-3-N-(3,4,5-trifluorophenyl)benzene-1,3-diamine.
| Compound Name | 5-nitro-3-N-(3,4,5-trifluorophenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 80824941 |
| Molecular Formula | C12H8F3N3O2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 5-nitro-3-N-(3,4,5-trifluorophenyl)benzene-1,3-diamine |
| SMILES | Nc1cc(Nc2cc(F)c(F)c(F)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H8F3N3O2/c13-10-4-8(5-11(14)12(10)15)17-7-1-6(16)2-9(3-7)18(19)20/h1-5,17H,16H2 |
| InChIKey | RPEIZWXZYHDFEG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|