C12H5F5N2O2 — CID 107645553
2,3,5,6-tetrafluoro-N-(3-fluoro-5-nitrophenyl)aniline (PubChem CID 107645553) has the molecular formula C12H5F5N2O2 and a molecular weight of 304.17 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(3-fluoro-5-nitrophenyl)aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-(3-fluoro-5-nitrophenyl)aniline |
|---|---|
| PubChem CID | 107645553 |
| Molecular Formula | C12H5F5N2O2 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(3-fluoro-5-nitrophenyl)aniline |
| SMILES | O=[N+]([O-])c1cc(F)cc(Nc2c(F)c(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C12H5F5N2O2/c13-5-1-6(3-7(2-5)19(20)21)18-12-10(16)8(14)4-9(15)11(12)17/h1-4,18H |
| InChIKey | DOZFOBJFMGLQNG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|