C12H6Cl2F4N2O2 — CID 159546994
3-chloro-4,5-difluoroaniline;1-chloro-2,3-difluoro-5-nitrobenzene (PubChem CID 159546994) has the molecular formula C12H6Cl2F4N2O2 and a molecular weight of 357.09 g/mol. Its IUPAC name is 3-chloro-4,5-difluoroaniline;1-chloro-2,3-difluoro-5-nitrobenzene.
| Compound Name | 3-chloro-4,5-difluoroaniline;1-chloro-2,3-difluoro-5-nitrobenzene |
|---|---|
| PubChem CID | 159546994 |
| Molecular Formula | C12H6Cl2F4N2O2 |
| Molecular Weight | 357.09 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 3-chloro-4,5-difluoroaniline;1-chloro-2,3-difluoro-5-nitrobenzene |
| SMILES | Nc1cc(F)c(F)c(Cl)c1.O=[N+]([O-])c1cc(F)c(F)c(Cl)c1 |
| InChI | InChI=1S/C6H2ClF2NO2.C6H4ClF2N/c7-4-1-3(10(11)12)2-5(8)6(4)9;7-4-1-3(10)2-5(8)6(4)9/h1-2H;1-2H,10H2 |
| InChIKey | MEXRATXRIDLRFX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.09 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|