C16H14F2N2O4 — CID 159692780
7-fluoro-2,3-dihydro-1-benzofuran-5-amine;7-fluoro-5-nitro-2,3-dihydro-1-benzofuran (PubChem CID 159692780) has the molecular formula C16H14F2N2O4 and a molecular weight of 336.29 g/mol. Its IUPAC name is 7-fluoro-2,3-dihydro-1-benzofuran-5-amine;7-fluoro-5-nitro-2,3-dihydro-1-benzofuran.
| Compound Name | 7-fluoro-2,3-dihydro-1-benzofuran-5-amine;7-fluoro-5-nitro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 159692780 |
| Molecular Formula | C16H14F2N2O4 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 7-fluoro-2,3-dihydro-1-benzofuran-5-amine;7-fluoro-5-nitro-2,3-dihydro-1-benzofuran |
| SMILES | Nc1cc(F)c2c(c1)CCO2.O=[N+]([O-])c1cc(F)c2c(c1)CCO2 |
| InChI | InChI=1S/C8H6FNO3.C8H8FNO/c9-7-4-6(10(11)12)3-5-1-2-13-8(5)7;9-7-4-6(10)3-5-1-2-11-8(5)7/h3-4H,1-2H2;3-4H,1-2,10H2 |
| InChIKey | MWPXGLOJYKPYHI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|