C8H8N2O4 — CID 131563649
7-nitro-2,3-dihydro-1,4-benzodioxin-5-amine (PubChem CID 131563649) has the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. Its IUPAC name is 7-nitro-2,3-dihydro-1,4-benzodioxin-5-amine.
| Compound Name | 7-nitro-2,3-dihydro-1,4-benzodioxin-5-amine |
|---|---|
| PubChem CID | 131563649 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 7-nitro-2,3-dihydro-1,4-benzodioxin-5-amine |
| SMILES | Nc1cc([N+](=O)[O-])cc2c1OCCO2 |
| InChI | InChI=1S/C8H8N2O4/c9-6-3-5(10(11)12)4-7-8(6)14-2-1-13-7/h3-4H,1-2,9H2 |
| InChIKey | ZOTHQBSFEYNDTL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|