About 8-amino-6-nitro-2,3-dihydrochromen-4-one
8-amino-6-nitro-2,3-dihydrochromen-4-one (PubChem CID 130054581) has the molecular formula C9H8N2O4
and a molecular weight of 208.17 g/mol. Its IUPAC name is 8-amino-6-nitro-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 8-amino-6-nitro-2,3-dihydrochromen-4-one |
| PubChem CID | 130054581 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 8-amino-6-nitro-2,3-dihydrochromen-4-one |
| SMILES | Nc1cc([N+](=O)[O-])cc2c1OCCC2=O |
| InChI | InChI=1S/C9H8N2O4/c10-7-4-5(11(13)14)3-6-8(12)1-2-15-9(6)7/h3-4H,1-2,10H2 |
| InChIKey | QHOKTHZYWRVTAK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-6-nitro-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-6-nitro-2,3-dihydrochromen-4-one?
The IUPAC name of 8-amino-6-nitro-2,3-dihydrochromen-4-one (CID 130054581) is 8-amino-6-nitro-2,3-dihydrochromen-4-one.
What is the SMILES notation for 8-amino-6-nitro-2,3-dihydrochromen-4-one?
The canonical SMILES for 8-amino-6-nitro-2,3-dihydrochromen-4-one is Nc1cc([N+](=O)[O-])cc2c1OCCC2=O.
What is the InChIKey of 8-amino-6-nitro-2,3-dihydrochromen-4-one?
The InChIKey is QHOKTHZYWRVTAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O4/c10-7-4-5(11(13)14)3-6-8(12)1-2-15-9(6)7/h3-4H,1-2,10H2.
What are the key properties of 8-amino-6-nitro-2,3-dihydrochromen-4-one?
8-amino-6-nitro-2,3-dihydrochromen-4-one has a molecular weight of 208.17 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-6-nitro-2,3-dihydrochromen-4-one is sourced from PubChem (CID 130054581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).