C10H11ClN2O4 — CID 15013613
7-chloro-8-nitro-2,3,4,5-tetrahydro-1,6-benzodioxocin-10-amine (PubChem CID 15013613) has the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. Its IUPAC name is 7-chloro-8-nitro-2,3,4,5-tetrahydro-1,6-benzodioxocin-10-amine.
| Compound Name | 7-chloro-8-nitro-2,3,4,5-tetrahydro-1,6-benzodioxocin-10-amine |
|---|---|
| PubChem CID | 15013613 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 7-chloro-8-nitro-2,3,4,5-tetrahydro-1,6-benzodioxocin-10-amine |
| SMILES | Nc1cc([N+](=O)[O-])c(Cl)c2c1OCCCCO2 |
| InChI | InChI=1S/C10H11ClN2O4/c11-8-7(13(14)15)5-6(12)9-10(8)17-4-2-1-3-16-9/h5H,1-4,12H2 |
| InChIKey | ZQBDMBGINQRYNX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|