C20H24N4O10 — CID 11134605
12,24-dinitro-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11,25-diamine (PubChem CID 11134605) has the molecular formula C20H24N4O10 and a molecular weight of 480.43 g/mol. Its IUPAC name is 12,24-dinitro-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11,25-diamine.
| Compound Name | 12,24-dinitro-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11,25-diamine |
|---|---|
| PubChem CID | 11134605 |
| Molecular Formula | C20H24N4O10 |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 12,24-dinitro-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene-11,25-diamine |
| SMILES | Nc1cc2c(cc1[N+](=O)[O-])OCCOCCOc1cc([N+](=O)[O-])c(N)cc1OCCOCCO2 |
| InChI | InChI=1S/C20H24N4O10/c21-13-9-17-19(11-15(13)23(25)26)33-7-3-30-4-8-34-20-12-16(24(27)28)14(22)10-18(20)32-6-2-29-1-5-31-17/h9-12H,1-8,21-22H2 |
| InChIKey | IRLVSRVZGIRDEC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 193.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|